C15H20O4 — CID 167549792
(E)-6-(3,4,5-trimethoxyphenyl)hex-2-enal (PubChem CID 167549792) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (E)-6-(3,4,5-trimethoxyphenyl)hex-2-enal.
| Compound Name | (E)-6-(3,4,5-trimethoxyphenyl)hex-2-enal |
|---|---|
| PubChem CID | 167549792 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (E)-6-(3,4,5-trimethoxyphenyl)hex-2-enal |
| SMILES | COc1cc(CCC/C=C/C=O)cc(OC)c1OC |
| InChI | InChI=1S/C15H20O4/c1-17-13-10-12(8-6-4-5-7-9-16)11-14(18-2)15(13)19-3/h5,7,9-11H,4,6,8H2,1-3H3/b7-5+ |
| InChIKey | CIBPJRHQJHWOFP-FNORWQNLSA-N |
| XLogP | 2.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|