C12H14O3 — CID 86067900
5-(4-hydroxy-3-methoxyphenyl)pent-2-enal (PubChem CID 86067900) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 5-(4-hydroxy-3-methoxyphenyl)pent-2-enal.
| Compound Name | 5-(4-hydroxy-3-methoxyphenyl)pent-2-enal |
|---|---|
| PubChem CID | 86067900 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 5-(4-hydroxy-3-methoxyphenyl)pent-2-enal |
| SMILES | COc1cc(CCC=CC=O)ccc1O |
| InChI | InChI=1S/C12H14O3/c1-15-12-9-10(6-7-11(12)14)5-3-2-4-8-13/h2,4,6-9,14H,3,5H2,1H3 |
| InChIKey | NJDMKYLEPGXOIO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|