C14H18O3 — CID 10130870
(E)-1-(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one (PubChem CID 10130870) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (E)-1-(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one.
| Compound Name | (E)-1-(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one |
|---|---|
| PubChem CID | 10130870 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (E)-1-(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one |
| SMILES | CC/C=C/C(=O)CCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C14H18O3/c1-3-4-5-12(15)8-6-11-7-9-13(16)14(10-11)17-2/h4-5,7,9-10,16H,3,6,8H2,1-2H3/b5-4+ |
| InChIKey | UVMIENUNWLNKDK-SNAWJCMRSA-N |
| XLogP | 2.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|