C21H25NO5 — CID 156727803
(Z)-1-(4-amino-3-methoxyphenyl)-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one (PubChem CID 156727803) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is (Z)-1-(4-amino-3-methoxyphenyl)-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one.
| Compound Name | (Z)-1-(4-amino-3-methoxyphenyl)-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one |
|---|---|
| PubChem CID | 156727803 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (Z)-1-(4-amino-3-methoxyphenyl)-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one |
| SMILES | COc1cc(CCC(=O)/C=C(\O)CCc2ccc(O)c(OC)c2)ccc1N |
| InChI | InChI=1S/C21H25NO5/c1-26-20-11-14(5-9-18(20)22)3-7-16(23)13-17(24)8-4-15-6-10-19(25)21(12-15)27-2/h5-6,9-13,24-25H,3-4,7-8,22H2,1-2H3/b17-13- |
| InChIKey | CNZJJNLMQCJUFZ-LGMDPLHJSA-N |
| XLogP | 3.57 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|