C17H24O4 — CID 162944026
(6R)-6-hydroxy-1-(4-hydroxy-3-methoxyphenyl)dec-4-en-3-one (PubChem CID 162944026) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (6R)-6-hydroxy-1-(4-hydroxy-3-methoxyphenyl)dec-4-en-3-one.
| Compound Name | (6R)-6-hydroxy-1-(4-hydroxy-3-methoxyphenyl)dec-4-en-3-one |
|---|---|
| PubChem CID | 162944026 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (6R)-6-hydroxy-1-(4-hydroxy-3-methoxyphenyl)dec-4-en-3-one |
| SMILES | CCCC[C@@H](O)C=CC(=O)CCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C17H24O4/c1-3-4-5-14(18)9-10-15(19)8-6-13-7-11-16(20)17(12-13)21-2/h7,9-12,14,18,20H,3-6,8H2,1-2H3/t14-/m1/s1 |
| InChIKey | SEWFXECKZBLANJ-CQSZACIVSA-N |
| XLogP | 3.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|