C20H32O4 — CID 86067818
1-(4-hydroxy-3-methoxyphenyl)-5-methoxydodecan-3-one (PubChem CID 86067818) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is 1-(4-hydroxy-3-methoxyphenyl)-5-methoxydodecan-3-one.
| Compound Name | 1-(4-hydroxy-3-methoxyphenyl)-5-methoxydodecan-3-one |
|---|---|
| PubChem CID | 86067818 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 1-(4-hydroxy-3-methoxyphenyl)-5-methoxydodecan-3-one |
| SMILES | CCCCCCCC(CC(=O)CCc1ccc(O)c(OC)c1)OC |
| InChI | InChI=1S/C20H32O4/c1-4-5-6-7-8-9-18(23-2)15-17(21)12-10-16-11-13-19(22)20(14-16)24-3/h11,13-14,18,22H,4-10,12,15H2,1-3H3 |
| InChIKey | FTJQWKHHXIINKC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|