C20H24O6 — CID 11660490
(5S)-1,7-bis(3,4-dihydroxyphenyl)-5-methoxyheptan-3-one (PubChem CID 11660490) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is (5S)-1,7-bis(3,4-dihydroxyphenyl)-5-methoxyheptan-3-one.
| Compound Name | (5S)-1,7-bis(3,4-dihydroxyphenyl)-5-methoxyheptan-3-one |
|---|---|
| PubChem CID | 11660490 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (5S)-1,7-bis(3,4-dihydroxyphenyl)-5-methoxyheptan-3-one |
| SMILES | CO[C@@H](CCc1ccc(O)c(O)c1)CC(=O)CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C20H24O6/c1-26-16(7-3-14-5-9-18(23)20(25)11-14)12-15(21)6-2-13-4-8-17(22)19(24)10-13/h4-5,8-11,16,22-25H,2-3,6-7,12H2,1H3/t16-/m0/s1 |
| InChIKey | KGQIYLSVVQCRJA-INIZCTEOSA-N |
| XLogP | 3.05 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|