C25H32O8 — CID 155406364
7-(3,4-dihydroxyphenyl)-1-(4-hydroxyphenyl)-5-[(1R,2R,3S,4R)-2,3,4-trihydroxycyclohexyl]oxyheptan-3-one (PubChem CID 155406364) has the molecular formula C25H32O8 and a molecular weight of 460.52 g/mol. Its IUPAC name is 7-(3,4-dihydroxyphenyl)-1-(4-hydroxyphenyl)-5-[(1R,2R,3S,4R)-2,3,4-trihydroxycyclohexyl]oxyheptan-3-one.
| Compound Name | 7-(3,4-dihydroxyphenyl)-1-(4-hydroxyphenyl)-5-[(1R,2R,3S,4R)-2,3,4-trihydroxycyclohexyl]oxyheptan-3-one |
|---|---|
| PubChem CID | 155406364 |
| Molecular Formula | C25H32O8 |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 7-(3,4-dihydroxyphenyl)-1-(4-hydroxyphenyl)-5-[(1R,2R,3S,4R)-2,3,4-trihydroxycyclohexyl]oxyheptan-3-one |
| SMILES | O=C(CCc1ccc(O)cc1)CC(CCc1ccc(O)c(O)c1)O[C@@H]1CC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H32O8/c26-17-6-1-15(2-7-17)3-8-18(27)14-19(9-4-16-5-10-20(28)22(30)13-16)33-23-12-11-21(29)24(31)25(23)32/h1-2,5-7,10,13,19,21,23-26,28-32H,3-4,8-9,11-12,14H2/t19?,21-,23-,24+,25+/m1/s1 |
| InChIKey | SUUVPYCIVITZKV-UGISFCQKSA-N |
| XLogP | 1.96 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|