C17H26O4 — CID 24871717
1-(3,4-dihydroxyphenyl)-5-methoxydecan-3-one (PubChem CID 24871717) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-5-methoxydecan-3-one.
| Compound Name | 1-(3,4-dihydroxyphenyl)-5-methoxydecan-3-one |
|---|---|
| PubChem CID | 24871717 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-5-methoxydecan-3-one |
| SMILES | CCCCCC(CC(=O)CCc1ccc(O)c(O)c1)OC |
| InChI | InChI=1S/C17H26O4/c1-3-4-5-6-15(21-2)12-14(18)9-7-13-8-10-16(19)17(20)11-13/h8,10-11,15,19-20H,3-7,9,12H2,1-2H3 |
| InChIKey | QPGWJFYAIOAOBB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|