C25H34O6 — CID 162837226
(3R,7R)-1-(3,4-dihydroxyphenyl)-3-hydroxy-7-(4-hydroxy-3-methoxyphenyl)dodecan-5-one (PubChem CID 162837226) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is (3R,7R)-1-(3,4-dihydroxyphenyl)-3-hydroxy-7-(4-hydroxy-3-methoxyphenyl)dodecan-5-one.
| Compound Name | (3R,7R)-1-(3,4-dihydroxyphenyl)-3-hydroxy-7-(4-hydroxy-3-methoxyphenyl)dodecan-5-one |
|---|---|
| PubChem CID | 162837226 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (3R,7R)-1-(3,4-dihydroxyphenyl)-3-hydroxy-7-(4-hydroxy-3-methoxyphenyl)dodecan-5-one |
| SMILES | CCCCC[C@H](CC(=O)C[C@H](O)CCc1ccc(O)c(O)c1)c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C25H34O6/c1-3-4-5-6-18(19-9-12-23(29)25(15-19)31-2)14-21(27)16-20(26)10-7-17-8-11-22(28)24(30)13-17/h8-9,11-13,15,18,20,26,28-30H,3-7,10,14,16H2,1-2H3/t18-,20-/m1/s1 |
| InChIKey | CUKAXRFUUWCENR-UYAOXDASSA-N |
| XLogP | 4.82 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|