C29H42O6 — CID 163096364
(3R,7R,10R)-1-(3,4-dihydroxyphenyl)-10-ethyl-3-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-12-methyltridecan-5-one (PubChem CID 163096364) has the molecular formula C29H42O6 and a molecular weight of 486.65 g/mol. Its IUPAC name is (3R,7R,10R)-1-(3,4-dihydroxyphenyl)-10-ethyl-3-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-12-methyltridecan-5-one.
| Compound Name | (3R,7R,10R)-1-(3,4-dihydroxyphenyl)-10-ethyl-3-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-12-methyltridecan-5-one |
|---|---|
| PubChem CID | 163096364 |
| Molecular Formula | C29H42O6 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | (3R,7R,10R)-1-(3,4-dihydroxyphenyl)-10-ethyl-3-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-12-methyltridecan-5-one |
| SMILES | CCC(CC[C@H](CC(=O)C[C@H](O)CCc1ccc(O)c(O)c1)c1ccc(O)c(OC)c1)CC(C)C |
| InChI | InChI=1S/C29H42O6/c1-5-20(14-19(2)3)6-9-22(23-10-13-27(33)29(17-23)35-4)16-25(31)18-24(30)11-7-21-8-12-26(32)28(34)15-21/h8,10,12-13,15,17,19-20,22,24,30,32-34H,5-7,9,11,14,16,18H2,1-4H3/t20?,22-,24-/m1/s1 |
| InChIKey | CLKDHIMIVSETEX-ATLRVMQYSA-N |
| XLogP | 6.09 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|