C21H27NO7 — CID 163012229
(5R)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxyheptan-3-one (PubChem CID 163012229) has the molecular formula C21H27NO7 and a molecular weight of 405.45 g/mol. Its IUPAC name is (5R)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxyheptan-3-one.
| Compound Name | (5R)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxyheptan-3-one |
|---|---|
| PubChem CID | 163012229 |
| Molecular Formula | C21H27NO7 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (5R)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxyheptan-3-one |
| SMILES | COc1cc(CC[C@@H](O)CC(=O)CCc2ccc(O)c(OCN)c2)cc(O)c1O |
| InChI | InChI=1S/C21H27NO7/c1-28-20-10-14(8-18(26)21(20)27)3-6-16(24)11-15(23)5-2-13-4-7-17(25)19(9-13)29-12-22/h4,7-10,16,24-27H,2-3,5-6,11-12,22H2,1H3/t16-/m1/s1 |
| InChIKey | UZNKGJJKXAZCCY-MRXNPFEDSA-N |
| XLogP | 1.99 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|