C32H41NO8 — CID 162939553
(5R,7R)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-[3,4-dihydroxy-5-[(3-hydroxyphenyl)methoxy]phenyl]-5-hydroxydodecan-3-one (PubChem CID 162939553) has the molecular formula C32H41NO8 and a molecular weight of 567.68 g/mol. Its IUPAC name is (5R,7R)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-[3,4-dihydroxy-5-[(3-hydroxyphenyl)methoxy]phenyl]-5-hydroxydodecan-3-one.
| Compound Name | (5R,7R)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-[3,4-dihydroxy-5-[(3-hydroxyphenyl)methoxy]phenyl]-5-hydroxydodecan-3-one |
|---|---|
| PubChem CID | 162939553 |
| Molecular Formula | C32H41NO8 |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | (5R,7R)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-[3,4-dihydroxy-5-[(3-hydroxyphenyl)methoxy]phenyl]-5-hydroxydodecan-3-one |
| SMILES | CCCCC[C@H](C[C@@H](O)CC(=O)CCc1ccc(O)c(OCN)c1)c1cc(O)c(O)c(OCc2cccc(O)c2)c1 |
| InChI | InChI=1S/C32H41NO8/c1-2-3-4-7-23(15-27(36)18-26(35)11-9-21-10-12-28(37)30(14-21)41-20-33)24-16-29(38)32(39)31(17-24)40-19-22-6-5-8-25(34)13-22/h5-6,8,10,12-14,16-17,23,27,34,36-39H,2-4,7,9,11,15,18-20,33H2,1H3/t23-,27-/m1/s1 |
| InChIKey | MQAATIMVLNZSFX-YIXXDRMTSA-N |
| XLogP | 5.39 |
| TPSA | 162.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|