C41H52O5 — CID 163102221
(5S)-5-hydroxy-1-[3-[(6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-12-(2-pentylphenyl)dodecan-3-one (PubChem CID 163102221) has the molecular formula C41H52O5 and a molecular weight of 624.86 g/mol. Its IUPAC name is (5S)-5-hydroxy-1-[3-[(6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-12-(2-pentylphenyl)dodecan-3-one.
| Compound Name | (5S)-5-hydroxy-1-[3-[(6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-12-(2-pentylphenyl)dodecan-3-one |
|---|---|
| PubChem CID | 163102221 |
| Molecular Formula | C41H52O5 |
| Molecular Weight | 624.86 g/mol |
| Exact Mass | 624.38 |
| IUPAC Name | (5S)-5-hydroxy-1-[3-[(6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-12-(2-pentylphenyl)dodecan-3-one |
| SMILES | CCCCCc1ccccc1CCCCCCC[C@H](O)CC(=O)CCc1ccc(OC)c(OCc2ccc3cc(O)ccc3c2)c1 |
| InChI | InChI=1S/C41H52O5/c1-3-4-8-13-33-15-11-12-16-34(33)14-9-6-5-7-10-17-37(42)29-39(44)23-19-31-20-25-40(45-2)41(27-31)46-30-32-18-21-36-28-38(43)24-22-35(36)26-32/h11-12,15-16,18,20-22,24-28,37,42-43H,3-10,13-14,17,19,23,29-30H2,1-2H3/t37-/m0/s1 |
| InChIKey | CUXYKEZJWYQINB-QNGWXLTQSA-N |
| XLogP | 9.70 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.86 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|