C38H46O6 — CID 162826866
(5S,7S)-5-hydroxy-7-(2-hydroxyethyl)-1-[3-[(6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-12-phenyldodecan-3-one (PubChem CID 162826866) has the molecular formula C38H46O6 and a molecular weight of 598.78 g/mol. Its IUPAC name is (5S,7S)-5-hydroxy-7-(2-hydroxyethyl)-1-[3-[(6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-12-phenyldodecan-3-one.
| Compound Name | (5S,7S)-5-hydroxy-7-(2-hydroxyethyl)-1-[3-[(6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-12-phenyldodecan-3-one |
|---|---|
| PubChem CID | 162826866 |
| Molecular Formula | C38H46O6 |
| Molecular Weight | 598.78 g/mol |
| Exact Mass | 598.33 |
| IUPAC Name | (5S,7S)-5-hydroxy-7-(2-hydroxyethyl)-1-[3-[(6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-12-phenyldodecan-3-one |
| SMILES | COc1ccc(CCC(=O)C[C@@H](O)CC(CCO)CCCCCc2ccccc2)cc1OCc1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C38H46O6/c1-43-37-19-14-30(24-38(37)44-27-31-12-15-33-25-34(40)18-16-32(33)22-31)13-17-35(41)26-36(42)23-29(20-21-39)11-7-3-6-10-28-8-4-2-5-9-28/h2,4-5,8-9,12,14-16,18-19,22,24-25,29,36,39-40,42H,3,6-7,10-11,13,17,20-21,23,26-27H2,1H3/t29?,36-/m0/s1 |
| InChIKey | JOQMAMXOBBXTGJ-RDFKHQOOSA-N |
| XLogP | 7.58 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.78 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|