C39H49NO6 — CID 163100795
5-hydroxy-1-[3-[(6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-12-[3-(2-hydroxypropylamino)phenyl]dodecan-3-one (PubChem CID 163100795) has the molecular formula C39H49NO6 and a molecular weight of 627.82 g/mol. Its IUPAC name is 5-hydroxy-1-[3-[(6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-12-[3-(2-hydroxypropylamino)phenyl]dodecan-3-one.
| Compound Name | 5-hydroxy-1-[3-[(6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-12-[3-(2-hydroxypropylamino)phenyl]dodecan-3-one |
|---|---|
| PubChem CID | 163100795 |
| Molecular Formula | C39H49NO6 |
| Molecular Weight | 627.82 g/mol |
| Exact Mass | 627.36 |
| IUPAC Name | 5-hydroxy-1-[3-[(6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-12-[3-(2-hydroxypropylamino)phenyl]dodecan-3-one |
| SMILES | COc1ccc(CCC(=O)CC(O)CCCCCCCc2cccc(NCC(C)O)c2)cc1OCc1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C39H49NO6/c1-28(41)26-40-34-11-8-10-29(22-34)9-6-4-3-5-7-12-35(42)25-37(44)18-14-30-15-20-38(45-2)39(23-30)46-27-31-13-16-33-24-36(43)19-17-32(33)21-31/h8,10-11,13,15-17,19-24,28,35,40-43H,3-7,9,12,14,18,25-27H2,1-2H3 |
| InChIKey | YQXJRJPYUKWDGI-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.82 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|