C31H40O5 — CID 162959059
1-[3-[(8-ethyl-6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-5-hydroxyundecan-3-one (PubChem CID 162959059) has the molecular formula C31H40O5 and a molecular weight of 492.66 g/mol. Its IUPAC name is 1-[3-[(8-ethyl-6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-5-hydroxyundecan-3-one.
| Compound Name | 1-[3-[(8-ethyl-6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-5-hydroxyundecan-3-one |
|---|---|
| PubChem CID | 162959059 |
| Molecular Formula | C31H40O5 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | 1-[3-[(8-ethyl-6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-5-hydroxyundecan-3-one |
| SMILES | CCCCCCC(O)CC(=O)CCc1ccc(OC)c(OCc2ccc3cc(O)cc(CC)c3c2)c1 |
| InChI | InChI=1S/C31H40O5/c1-4-6-7-8-9-26(32)20-27(33)14-11-22-12-15-30(35-3)31(17-22)36-21-23-10-13-25-19-28(34)18-24(5-2)29(25)16-23/h10,12-13,15-19,26,32,34H,4-9,11,14,20-21H2,1-3H3 |
| InChIKey | VFZUFYCQJUJUHS-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|