C38H46O5 — CID 163098453
1-[3-[(8-ethyl-6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-5-hydroxy-12-phenyldodecan-3-one (PubChem CID 163098453) has the molecular formula C38H46O5 and a molecular weight of 582.78 g/mol. Its IUPAC name is 1-[3-[(8-ethyl-6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-5-hydroxy-12-phenyldodecan-3-one.
| Compound Name | 1-[3-[(8-ethyl-6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-5-hydroxy-12-phenyldodecan-3-one |
|---|---|
| PubChem CID | 163098453 |
| Molecular Formula | C38H46O5 |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.33 |
| IUPAC Name | 1-[3-[(8-ethyl-6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-5-hydroxy-12-phenyldodecan-3-one |
| SMILES | CCc1cc(O)cc2ccc(COc3cc(CCC(=O)CC(O)CCCCCCCc4ccccc4)ccc3OC)cc12 |
| InChI | InChI=1S/C38H46O5/c1-3-31-24-35(41)25-32-19-16-30(22-36(31)32)27-43-38-23-29(18-21-37(38)42-2)17-20-34(40)26-33(39)15-11-6-4-5-8-12-28-13-9-7-10-14-28/h7,9-10,13-14,16,18-19,21-25,33,39,41H,3-6,8,11-12,15,17,20,26-27H2,1-2H3 |
| InChIKey | BCOYFKZNSZQMLX-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|