C27H38O5 — CID 162896568
(5S,10S)-1-(3,4-dimethoxyphenyl)-5-hydroxy-10-(hydroxymethyl)-12-phenyldodecan-3-one (PubChem CID 162896568) has the molecular formula C27H38O5 and a molecular weight of 442.60 g/mol. Its IUPAC name is (5S,10S)-1-(3,4-dimethoxyphenyl)-5-hydroxy-10-(hydroxymethyl)-12-phenyldodecan-3-one.
| Compound Name | (5S,10S)-1-(3,4-dimethoxyphenyl)-5-hydroxy-10-(hydroxymethyl)-12-phenyldodecan-3-one |
|---|---|
| PubChem CID | 162896568 |
| Molecular Formula | C27H38O5 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | (5S,10S)-1-(3,4-dimethoxyphenyl)-5-hydroxy-10-(hydroxymethyl)-12-phenyldodecan-3-one |
| SMILES | COc1ccc(CCC(=O)C[C@@H](O)CCCC[C@H](CO)CCc2ccccc2)cc1OC |
| InChI | InChI=1S/C27H38O5/c1-31-26-17-15-22(18-27(26)32-2)14-16-25(30)19-24(29)11-7-6-10-23(20-28)13-12-21-8-4-3-5-9-21/h3-5,8-9,15,17-18,23-24,28-29H,6-7,10-14,16,19-20H2,1-2H3/t23-,24-/m0/s1 |
| InChIKey | ZXRVDRAGECDIJL-ZEQRLZLVSA-N |
| XLogP | 4.76 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|