C31H46O4 — CID 162887606
(5S)-1-(3,4-dimethoxyphenyl)-5-hydroxy-12-(2-pentylphenyl)dodecan-3-one (PubChem CID 162887606) has the molecular formula C31H46O4 and a molecular weight of 482.71 g/mol. Its IUPAC name is (5S)-1-(3,4-dimethoxyphenyl)-5-hydroxy-12-(2-pentylphenyl)dodecan-3-one.
| Compound Name | (5S)-1-(3,4-dimethoxyphenyl)-5-hydroxy-12-(2-pentylphenyl)dodecan-3-one |
|---|---|
| PubChem CID | 162887606 |
| Molecular Formula | C31H46O4 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | (5S)-1-(3,4-dimethoxyphenyl)-5-hydroxy-12-(2-pentylphenyl)dodecan-3-one |
| SMILES | CCCCCc1ccccc1CCCCCCC[C@H](O)CC(=O)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C31H46O4/c1-4-5-9-14-26-16-12-13-17-27(26)15-10-7-6-8-11-18-28(32)24-29(33)21-19-25-20-22-30(34-2)31(23-25)35-3/h12-13,16-17,20,22-23,28,32H,4-11,14-15,18-19,21,24H2,1-3H3/t28-/m0/s1 |
| InChIKey | ZQAZYUCESXTFBU-NDEPHWFRSA-N |
| XLogP | 7.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|