C19H32O5 — CID 175608112
ethanol;5-hydroxy-1-(3-hydroxy-4-methoxyphenyl)decan-3-one (PubChem CID 175608112) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is ethanol;5-hydroxy-1-(3-hydroxy-4-methoxyphenyl)decan-3-one.
| Compound Name | ethanol;5-hydroxy-1-(3-hydroxy-4-methoxyphenyl)decan-3-one |
|---|---|
| PubChem CID | 175608112 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | ethanol;5-hydroxy-1-(3-hydroxy-4-methoxyphenyl)decan-3-one |
| SMILES | CCCCCC(O)CC(=O)CCc1ccc(OC)c(O)c1.CCO |
| InChI | InChI=1S/C17H26O4.C2H6O/c1-3-4-5-6-14(18)12-15(19)9-7-13-8-10-17(21-2)16(20)11-13;1-2-3/h8,10-11,14,18,20H,3-7,9,12H2,1-2H3;3H,2H2,1H3 |
| InChIKey | FGNMGMXGGOUIET-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|