C19H32O4 — CID 163030522
(3R,5S)-1-(3-hydroxy-4-methoxyphenyl)dodecane-3,5-diol (PubChem CID 163030522) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is (3R,5S)-1-(3-hydroxy-4-methoxyphenyl)dodecane-3,5-diol.
| Compound Name | (3R,5S)-1-(3-hydroxy-4-methoxyphenyl)dodecane-3,5-diol |
|---|---|
| PubChem CID | 163030522 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | (3R,5S)-1-(3-hydroxy-4-methoxyphenyl)dodecane-3,5-diol |
| SMILES | CCCCCCC[C@H](O)C[C@H](O)CCc1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C19H32O4/c1-3-4-5-6-7-8-16(20)14-17(21)11-9-15-10-12-19(23-2)18(22)13-15/h10,12-13,16-17,20-22H,3-9,11,14H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | VOLOKUOZNMNWDI-DLBZAZTESA-N |
| XLogP | 3.81 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|