C18H28O4 — CID 101095743
10-(3,4-dimethoxyphenyl)-9-hydroxydecan-5-one (PubChem CID 101095743) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is 10-(3,4-dimethoxyphenyl)-9-hydroxydecan-5-one.
| Compound Name | 10-(3,4-dimethoxyphenyl)-9-hydroxydecan-5-one |
|---|---|
| PubChem CID | 101095743 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 10-(3,4-dimethoxyphenyl)-9-hydroxydecan-5-one |
| SMILES | CCCCC(=O)CCCC(O)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C18H28O4/c1-4-5-7-15(19)8-6-9-16(20)12-14-10-11-17(21-2)18(13-14)22-3/h10-11,13,16,20H,4-9,12H2,1-3H3 |
| InChIKey | VUBSKRVZFXPQJQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |