C21H38ClO2P — CID 71414193
tributyl-[(3,4-dimethoxyphenyl)methyl]phosphanium chloride (PubChem CID 71414193) has the molecular formula C21H38ClO2P and a molecular weight of 388.96 g/mol. Its IUPAC name is tributyl-[(3,4-dimethoxyphenyl)methyl]phosphanium chloride.
| Compound Name | tributyl-[(3,4-dimethoxyphenyl)methyl]phosphanium chloride |
|---|---|
| PubChem CID | 71414193 |
| Molecular Formula | C21H38ClO2P |
| Molecular Weight | 388.96 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | tributyl-[(3,4-dimethoxyphenyl)methyl]phosphanium chloride |
| SMILES | CCCC[P+](CCCC)(CCCC)Cc1ccc(OC)c(OC)c1.[Cl-] |
| InChI | InChI=1S/C21H38O2P.ClH/c1-6-9-14-24(15-10-7-2,16-11-8-3)18-19-12-13-20(22-4)21(17-19)23-5;/h12-13,17H,6-11,14-16,18H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | BGCDRFNYMWRGDO-UHFFFAOYSA-M |
| XLogP | 3.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.96 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|