C27H36O5 — CID 67875629
[2-(5-hydroxy-3-oxododecyl)phenyl] 3-methoxy-4-methylbenzoate (PubChem CID 67875629) has the molecular formula C27H36O5 and a molecular weight of 440.58 g/mol. Its IUPAC name is [2-(5-hydroxy-3-oxododecyl)phenyl] 3-methoxy-4-methylbenzoate.
| Compound Name | [2-(5-hydroxy-3-oxododecyl)phenyl] 3-methoxy-4-methylbenzoate |
|---|---|
| PubChem CID | 67875629 |
| Molecular Formula | C27H36O5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | [2-(5-hydroxy-3-oxododecyl)phenyl] 3-methoxy-4-methylbenzoate |
| SMILES | CCCCCCCC(O)CC(=O)CCc1ccccc1OC(=O)c1ccc(C)c(OC)c1 |
| InChI | InChI=1S/C27H36O5/c1-4-5-6-7-8-12-23(28)19-24(29)17-16-21-11-9-10-13-25(21)32-27(30)22-15-14-20(2)26(18-22)31-3/h9-11,13-15,18,23,28H,4-8,12,16-17,19H2,1-3H3 |
| InChIKey | HJKUFDUECLMEME-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|