C38H47NO5 — CID 162834669
(5S)-12-[3-(ethylamino)phenyl]-5-hydroxy-1-[3-[(6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]dodecan-3-one (PubChem CID 162834669) has the molecular formula C38H47NO5 and a molecular weight of 597.80 g/mol. Its IUPAC name is (5S)-12-[3-(ethylamino)phenyl]-5-hydroxy-1-[3-[(6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]dodecan-3-one.
| Compound Name | (5S)-12-[3-(ethylamino)phenyl]-5-hydroxy-1-[3-[(6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]dodecan-3-one |
|---|---|
| PubChem CID | 162834669 |
| Molecular Formula | C38H47NO5 |
| Molecular Weight | 597.80 g/mol |
| Exact Mass | 597.35 |
| IUPAC Name | (5S)-12-[3-(ethylamino)phenyl]-5-hydroxy-1-[3-[(6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]dodecan-3-one |
| SMILES | CCNc1cccc(CCCCCCC[C@H](O)CC(=O)CCc2ccc(OC)c(OCc3ccc4cc(O)ccc4c3)c2)c1 |
| InChI | InChI=1S/C38H47NO5/c1-3-39-33-12-9-11-28(23-33)10-7-5-4-6-8-13-34(40)26-36(42)19-15-29-16-21-37(43-2)38(24-29)44-27-30-14-17-32-25-35(41)20-18-31(32)22-30/h9,11-12,14,16-18,20-25,34,39-41H,3-8,10,13,15,19,26-27H2,1-2H3/t34-/m0/s1 |
| InChIKey | QQOYTHXPQDVULO-UMSFTDKQSA-N |
| XLogP | 8.40 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.80 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|