C40H51N3O5 — CID 163083685
1-[3-[(8S)-12-[3-[(8-ethyl-6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-8-hydroxy-10-oxododecyl]phenyl]-2-methylguanidine (PubChem CID 163083685) has the molecular formula C40H51N3O5 and a molecular weight of 653.86 g/mol. Its IUPAC name is 1-[3-[(8S)-12-[3-[(8-ethyl-6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-8-hydroxy-10-oxododecyl]phenyl]-2-methylguanidine.
| Compound Name | 1-[3-[(8S)-12-[3-[(8-ethyl-6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-8-hydroxy-10-oxododecyl]phenyl]-2-methylguanidine |
|---|---|
| PubChem CID | 163083685 |
| Molecular Formula | C40H51N3O5 |
| Molecular Weight | 653.86 g/mol |
| Exact Mass | 653.38 |
| IUPAC Name | 1-[3-[(8S)-12-[3-[(8-ethyl-6-hydroxynaphthalen-2-yl)methoxy]-4-methoxyphenyl]-8-hydroxy-10-oxododecyl]phenyl]-2-methylguanidine |
| SMILES | CCc1cc(O)cc2ccc(COc3cc(CCC(=O)C[C@@H](O)CCCCCCCc4cccc(N/C(N)=N/C)c4)ccc3OC)cc12 |
| InChI | InChI=1S/C40H51N3O5/c1-4-31-24-36(46)25-32-18-15-30(22-37(31)32)27-48-39-23-29(17-20-38(39)47-3)16-19-35(45)26-34(44)14-9-7-5-6-8-11-28-12-10-13-33(21-28)43-40(41)42-2/h10,12-13,15,17-18,20-25,34,44,46H,4-9,11,14,16,19,26-27H2,1-3H3,(H3,41,42,43)/t34-/m0/s1 |
| InChIKey | MWMFBJIECBHTGB-UMSFTDKQSA-N |
| XLogP | 7.89 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.86 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|