C23H32O4 — CID 22640074
2-(3-phenylpropyl)-5-(3,4,5-trimethoxyphenyl)pentan-1-ol (PubChem CID 22640074) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-(3-phenylpropyl)-5-(3,4,5-trimethoxyphenyl)pentan-1-ol.
| Compound Name | 2-(3-phenylpropyl)-5-(3,4,5-trimethoxyphenyl)pentan-1-ol |
|---|---|
| PubChem CID | 22640074 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 2-(3-phenylpropyl)-5-(3,4,5-trimethoxyphenyl)pentan-1-ol |
| SMILES | COc1cc(CCCC(CO)CCCc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H32O4/c1-25-21-15-20(16-22(26-2)23(21)27-3)14-8-13-19(17-24)12-7-11-18-9-5-4-6-10-18/h4-6,9-10,15-16,19,24H,7-8,11-14,17H2,1-3H3 |
| InChIKey | UGHSGMCONRXWQF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |