C23H30O4 — CID 163100079
(5R)-5-hydroxy-1-[4-hydroxy-3-(3-phenylpropoxy)phenyl]octan-3-one (PubChem CID 163100079) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is (5R)-5-hydroxy-1-[4-hydroxy-3-(3-phenylpropoxy)phenyl]octan-3-one.
| Compound Name | (5R)-5-hydroxy-1-[4-hydroxy-3-(3-phenylpropoxy)phenyl]octan-3-one |
|---|---|
| PubChem CID | 163100079 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | (5R)-5-hydroxy-1-[4-hydroxy-3-(3-phenylpropoxy)phenyl]octan-3-one |
| SMILES | CCC[C@@H](O)CC(=O)CCc1ccc(O)c(OCCCc2ccccc2)c1 |
| InChI | InChI=1S/C23H30O4/c1-2-7-20(24)17-21(25)13-11-19-12-14-22(26)23(16-19)27-15-6-10-18-8-4-3-5-9-18/h3-5,8-9,12,14,16,20,24,26H,2,6-7,10-11,13,15,17H2,1H3/t20-/m1/s1 |
| InChIKey | BAPNGZFOSZLAID-HXUWFJFHSA-N |
| XLogP | 4.46 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|