C31H39N2O4+ — CID 163182042
(5R)-5-hydroxy-1-[4-hydroxy-3-[[3-(2-phenylethyl)-5,6-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl]methoxy]phenyl]decan-3-one (PubChem CID 163182042) has the molecular formula C31H39N2O4+ and a molecular weight of 503.66 g/mol. Its IUPAC name is (5R)-5-hydroxy-1-[4-hydroxy-3-[[3-(2-phenylethyl)-5,6-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl]methoxy]phenyl]decan-3-one.
| Compound Name | (5R)-5-hydroxy-1-[4-hydroxy-3-[[3-(2-phenylethyl)-5,6-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl]methoxy]phenyl]decan-3-one |
|---|---|
| PubChem CID | 163182042 |
| Molecular Formula | C31H39N2O4+ |
| Molecular Weight | 503.66 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | (5R)-5-hydroxy-1-[4-hydroxy-3-[[3-(2-phenylethyl)-5,6-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl]methoxy]phenyl]decan-3-one |
| SMILES | CCCCC[C@@H](O)CC(=O)CCc1ccc(O)c(OC[NH+]2C=C3C(CCc4ccccc4)=CN=C3C2)c1 |
| InChI | InChI=1S/C31H38N2O4/c1-2-3-5-10-26(34)18-27(35)15-12-24-13-16-30(36)31(17-24)37-22-33-20-28-25(19-32-29(28)21-33)14-11-23-8-6-4-7-9-23/h4,6-9,13,16-17,19-20,26,34,36H,2-3,5,10-12,14-15,18,21-22H2,1H3/p+1/t26-/m1/s1 |
| InChIKey | ZMAWTKMIISENOT-AREMUKBSSA-O |
| XLogP | 4.32 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.66 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|