C33H41N4O5+ — CID 163148621
1-[3-[[3-[(1-amino-1,2-dihydroisoquinolin-5-yl)methyl]-5,6-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl]methoxy]-4-hydroxyphenyl]-5,7-dihydroxydecan-3-one (PubChem CID 163148621) has the molecular formula C33H41N4O5+ and a molecular weight of 573.71 g/mol. Its IUPAC name is 1-[3-[[3-[(1-amino-1,2-dihydroisoquinolin-5-yl)methyl]-5,6-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl]methoxy]-4-hydroxyphenyl]-5,7-dihydroxydecan-3-one.
| Compound Name | 1-[3-[[3-[(1-amino-1,2-dihydroisoquinolin-5-yl)methyl]-5,6-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl]methoxy]-4-hydroxyphenyl]-5,7-dihydroxydecan-3-one |
|---|---|
| PubChem CID | 163148621 |
| Molecular Formula | C33H41N4O5+ |
| Molecular Weight | 573.71 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | 1-[3-[[3-[(1-amino-1,2-dihydroisoquinolin-5-yl)methyl]-5,6-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl]methoxy]-4-hydroxyphenyl]-5,7-dihydroxydecan-3-one |
| SMILES | CCCC(O)CC(O)CC(=O)CCc1ccc(O)c(OC[NH+]2C=C3C(Cc4cccc5c4C=CNC5N)=CN=C3C2)c1 |
| InChI | InChI=1S/C33H40N4O5/c1-2-4-24(38)15-26(40)16-25(39)9-7-21-8-10-31(41)32(13-21)42-20-37-18-29-23(17-36-30(29)19-37)14-22-5-3-6-28-27(22)11-12-35-33(28)34/h3,5-6,8,10-13,17-18,24,26,33,35,38,40-41H,2,4,7,9,14-16,19-20,34H2,1H3/p+1 |
| InChIKey | MMYOQIGNZDTBSG-UHFFFAOYSA-O |
| XLogP | 2.43 |
| TPSA | 141.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.71 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |