C39H49N4O5+ — CID 163152589
1-[3-[[3-[[3-[amino-(2-phenylethylamino)methyl]phenyl]methyl]-4,5-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl]methoxy]-4-hydroxyphenyl]-5,7-dihydroxydecan-3-one (PubChem CID 163152589) has the molecular formula C39H49N4O5+ and a molecular weight of 653.84 g/mol. Its IUPAC name is 1-[3-[[3-[[3-[amino-(2-phenylethylamino)methyl]phenyl]methyl]-4,5-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl]methoxy]-4-hydroxyphenyl]-5,7-dihydroxydecan-3-one.
| Compound Name | 1-[3-[[3-[[3-[amino-(2-phenylethylamino)methyl]phenyl]methyl]-4,5-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl]methoxy]-4-hydroxyphenyl]-5,7-dihydroxydecan-3-one |
|---|---|
| PubChem CID | 163152589 |
| Molecular Formula | C39H49N4O5+ |
| Molecular Weight | 653.84 g/mol |
| Exact Mass | 653.37 |
| IUPAC Name | 1-[3-[[3-[[3-[amino-(2-phenylethylamino)methyl]phenyl]methyl]-4,5-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl]methoxy]-4-hydroxyphenyl]-5,7-dihydroxydecan-3-one |
| SMILES | CCCC(O)CC(O)CC(=O)CCc1ccc(O)c(OC[NH+]2C=C3N=CC(Cc4cccc(C(N)NCCc5ccccc5)c4)=C3C2)c1 |
| InChI | InChI=1S/C39H48N4O5/c1-2-7-32(44)21-34(46)22-33(45)14-12-28-13-15-37(47)38(20-28)48-26-43-24-35-31(23-42-36(35)25-43)19-29-10-6-11-30(18-29)39(40)41-17-16-27-8-4-3-5-9-27/h3-6,8-11,13,15,18,20,23,25,32,34,39,41,44,46-47H,2,7,12,14,16-17,19,21-22,24,26,40H2,1H3/p+1 |
| InChIKey | NXCOYLRTKGSECQ-UHFFFAOYSA-O |
| XLogP | 3.69 |
| TPSA | 141.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.84 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|