C40H50N4O5 — CID 162828698
1-[3-[[3-[[5-[amino-(2-phenylethylamino)methyl]-2-(hydroxymethyl)phenyl]methyl]-1H-pyrrolo[3,4-b]pyrrol-5-yl]methoxy]-4-hydroxyphenyl]-5-hydroxydecan-3-one (PubChem CID 162828698) has the molecular formula C40H50N4O5 and a molecular weight of 666.86 g/mol. Its IUPAC name is 1-[3-[[3-[[5-[amino-(2-phenylethylamino)methyl]-2-(hydroxymethyl)phenyl]methyl]-1H-pyrrolo[3,4-b]pyrrol-5-yl]methoxy]-4-hydroxyphenyl]-5-hydroxydecan-3-one.
| Compound Name | 1-[3-[[3-[[5-[amino-(2-phenylethylamino)methyl]-2-(hydroxymethyl)phenyl]methyl]-1H-pyrrolo[3,4-b]pyrrol-5-yl]methoxy]-4-hydroxyphenyl]-5-hydroxydecan-3-one |
|---|---|
| PubChem CID | 162828698 |
| Molecular Formula | C40H50N4O5 |
| Molecular Weight | 666.86 g/mol |
| Exact Mass | 666.38 |
| IUPAC Name | 1-[3-[[3-[[5-[amino-(2-phenylethylamino)methyl]-2-(hydroxymethyl)phenyl]methyl]-1H-pyrrolo[3,4-b]pyrrol-5-yl]methoxy]-4-hydroxyphenyl]-5-hydroxydecan-3-one |
| SMILES | CCCCCC(O)CC(=O)CCc1ccc(O)c(OCn2cc3[nH]cc(Cc4cc(C(N)NCCc5ccccc5)ccc4CO)c3c2)c1 |
| InChI | InChI=1S/C40H50N4O5/c1-2-3-5-10-34(46)22-35(47)15-11-29-12-16-38(48)39(19-29)49-27-44-24-36-33(23-43-37(36)25-44)21-32-20-30(13-14-31(32)26-45)40(41)42-18-17-28-8-6-4-7-9-28/h4,6-9,12-14,16,19-20,23-25,34,40,42-43,45-46,48H,2-3,5,10-11,15,17-18,21-22,26-27,41H2,1H3 |
| InChIKey | KNXGPNFKHGVEHR-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 145.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.86 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|