C36H51N4O4+ — CID 163138467
(4R,5R)-1-[3-[[3-[[3-(diaminomethyl)phenyl]methyl]-5,6-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl]methoxy]-4-hydroxyphenyl]-5-hydroxy-4-pentyldecan-3-one (PubChem CID 163138467) has the molecular formula C36H51N4O4+ and a molecular weight of 603.83 g/mol. Its IUPAC name is (4R,5R)-1-[3-[[3-[[3-(diaminomethyl)phenyl]methyl]-5,6-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl]methoxy]-4-hydroxyphenyl]-5-hydroxy-4-pentyldecan-3-one.
| Compound Name | (4R,5R)-1-[3-[[3-[[3-(diaminomethyl)phenyl]methyl]-5,6-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl]methoxy]-4-hydroxyphenyl]-5-hydroxy-4-pentyldecan-3-one |
|---|---|
| PubChem CID | 163138467 |
| Molecular Formula | C36H51N4O4+ |
| Molecular Weight | 603.83 g/mol |
| Exact Mass | 603.39 |
| IUPAC Name | (4R,5R)-1-[3-[[3-[[3-(diaminomethyl)phenyl]methyl]-5,6-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl]methoxy]-4-hydroxyphenyl]-5-hydroxy-4-pentyldecan-3-one |
| SMILES | CCCCC[C@@H](O)[C@@H](CCCCC)C(=O)CCc1ccc(O)c(OC[NH+]2C=C3C(Cc4cccc(C(N)N)c4)=CN=C3C2)c1 |
| InChI | InChI=1S/C36H50N4O4/c1-3-5-7-12-29(32(41)13-8-6-4-2)33(42)16-14-25-15-17-34(43)35(20-25)44-24-40-22-30-28(21-39-31(30)23-40)19-26-10-9-11-27(18-26)36(37)38/h9-11,15,17-18,20-22,29,32,36,41,43H,3-8,12-14,16,19,23-24,37-38H2,1-2H3/p+1/t29-,32-/m1/s1 |
| InChIKey | IWLFCGOFRQOVAM-QLWXXVCSSA-O |
| XLogP | 4.65 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.83 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|