C40H57N4O4+ — CID 163158173
(4R,5R)-1-[3-[[3-[1-[3-(diaminomethyl)phenyl]cyclopentyl]-5,6-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl]methoxy]-4-hydroxyphenyl]-5-hydroxy-4-pentyldecan-3-one (PubChem CID 163158173) has the molecular formula C40H57N4O4+ and a molecular weight of 657.92 g/mol. Its IUPAC name is (4R,5R)-1-[3-[[3-[1-[3-(diaminomethyl)phenyl]cyclopentyl]-5,6-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl]methoxy]-4-hydroxyphenyl]-5-hydroxy-4-pentyldecan-3-one.
| Compound Name | (4R,5R)-1-[3-[[3-[1-[3-(diaminomethyl)phenyl]cyclopentyl]-5,6-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl]methoxy]-4-hydroxyphenyl]-5-hydroxy-4-pentyldecan-3-one |
|---|---|
| PubChem CID | 163158173 |
| Molecular Formula | C40H57N4O4+ |
| Molecular Weight | 657.92 g/mol |
| Exact Mass | 657.44 |
| IUPAC Name | (4R,5R)-1-[3-[[3-[1-[3-(diaminomethyl)phenyl]cyclopentyl]-5,6-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl]methoxy]-4-hydroxyphenyl]-5-hydroxy-4-pentyldecan-3-one |
| SMILES | CCCCC[C@@H](O)[C@@H](CCCCC)C(=O)CCc1ccc(O)c(OC[NH+]2C=C3C(C4(c5cccc(C(N)N)c5)CCCC4)=CN=C3C2)c1 |
| InChI | InChI=1S/C40H56N4O4/c1-3-5-7-14-31(35(45)15-8-6-4-2)36(46)18-16-28-17-19-37(47)38(22-28)48-27-44-25-32-33(24-43-34(32)26-44)40(20-9-10-21-40)30-13-11-12-29(23-30)39(41)42/h11-13,17,19,22-25,31,35,39,45,47H,3-10,14-16,18,20-21,26-27,41-42H2,1-2H3/p+1/t31-,35-/m1/s1 |
| InChIKey | PYOHDGGSSSXNCX-CYEXUTLASA-O |
| XLogP | 5.92 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.92 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|