C38H46N4O5 — CID 162827024
1-[3-[[3-(4-amino-3-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1,5(16),6,8-tetraen-10-yl)-1H-pyrrolo[3,4-b]pyrrol-5-yl]methoxy]-4-hydroxyphenyl]-5,7-dihydroxydecan-3-one (PubChem CID 162827024) has the molecular formula C38H46N4O5 and a molecular weight of 638.81 g/mol. Its IUPAC name is 1-[3-[[3-(4-amino-3-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1,5(16),6,8-tetraen-10-yl)-1H-pyrrolo[3,4-b]pyrrol-5-yl]methoxy]-4-hydroxyphenyl]-5,7-dihydroxydecan-3-one.
| Compound Name | 1-[3-[[3-(4-amino-3-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1,5(16),6,8-tetraen-10-yl)-1H-pyrrolo[3,4-b]pyrrol-5-yl]methoxy]-4-hydroxyphenyl]-5,7-dihydroxydecan-3-one |
|---|---|
| PubChem CID | 162827024 |
| Molecular Formula | C38H46N4O5 |
| Molecular Weight | 638.81 g/mol |
| Exact Mass | 638.35 |
| IUPAC Name | 1-[3-[[3-(4-amino-3-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1,5(16),6,8-tetraen-10-yl)-1H-pyrrolo[3,4-b]pyrrol-5-yl]methoxy]-4-hydroxyphenyl]-5,7-dihydroxydecan-3-one |
| SMILES | CCCC(O)CC(O)CC(=O)CCc1ccc(O)c(OCn2cc3[nH]cc(C45CCCC4CC4=CNC(N)c6cccc5c64)c3c2)c1 |
| InChI | InChI=1S/C38H46N4O5/c1-2-5-26(43)16-28(45)17-27(44)11-9-23-10-12-34(46)35(14-23)47-22-42-20-30-32(19-40-33(30)21-42)38-13-4-6-25(38)15-24-18-41-37(39)29-7-3-8-31(38)36(24)29/h3,7-8,10,12,14,18-21,25-26,28,37,40-41,43,45-46H,2,4-6,9,11,13,15-17,22,39H2,1H3 |
| InChIKey | OCPAPJACBUIJFL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 145.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.81 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |