C25H26O4 — CID 174471594
3-[4-[[4-hydroxy-3-(3-phenylpropoxy)phenyl]methyl]phenyl]propanoic acid (PubChem CID 174471594) has the molecular formula C25H26O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is 3-[4-[[4-hydroxy-3-(3-phenylpropoxy)phenyl]methyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[[4-hydroxy-3-(3-phenylpropoxy)phenyl]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 174471594 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 3-[4-[[4-hydroxy-3-(3-phenylpropoxy)phenyl]methyl]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(Cc2ccc(O)c(OCCCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H26O4/c26-23-14-12-22(17-21-10-8-20(9-11-21)13-15-25(27)28)18-24(23)29-16-4-7-19-5-2-1-3-6-19/h1-3,5-6,8-12,14,18,26H,4,7,13,15-17H2,(H,27,28) |
| InChIKey | SILDDIATLXMEIA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|