About 4-(3-ethoxy-4-hydroxyphenyl)butan-2-one;2-phenylethanol
4-(3-ethoxy-4-hydroxyphenyl)butan-2-one;2-phenylethanol (PubChem CID 137372095) has the molecular formula C20H26O4
and a molecular weight of 330.42 g/mol. Its IUPAC name is 4-(3-ethoxy-4-hydroxyphenyl)butan-2-one;2-phenylethanol.
Molecular Properties
| Compound Name | 4-(3-ethoxy-4-hydroxyphenyl)butan-2-one;2-phenylethanol |
| PubChem CID | 137372095 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 4-(3-ethoxy-4-hydroxyphenyl)butan-2-one;2-phenylethanol |
| SMILES | CCOc1cc(CCC(C)=O)ccc1O.OCCc1ccccc1 |
| InChI | InChI=1S/C12H16O3.C8H10O/c1-3-15-12-8-10(5-4-9(2)13)6-7-11(12)14;9-7-6-8-4-2-1-3-5-8/h6-8,14H,3-5H2,1-2H3;1-5,9H,6-7H2 |
| InChIKey | BDMMLNLDPIJZQX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3-ethoxy-4-hydroxyphenyl)butan-2-one;2-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-ethoxy-4-hydroxyphenyl)butan-2-one;2-phenylethanol?
The IUPAC name of 4-(3-ethoxy-4-hydroxyphenyl)butan-2-one;2-phenylethanol (CID 137372095) is 4-(3-ethoxy-4-hydroxyphenyl)butan-2-one;2-phenylethanol.
What is the SMILES notation for 4-(3-ethoxy-4-hydroxyphenyl)butan-2-one;2-phenylethanol?
The canonical SMILES for 4-(3-ethoxy-4-hydroxyphenyl)butan-2-one;2-phenylethanol is CCOc1cc(CCC(C)=O)ccc1O.OCCc1ccccc1.
What is the InChIKey of 4-(3-ethoxy-4-hydroxyphenyl)butan-2-one;2-phenylethanol?
The InChIKey is BDMMLNLDPIJZQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3.C8H10O/c1-3-15-12-8-10(5-4-9(2)13)6-7-11(12)14;9-7-6-8-4-2-1-3-5-8/h6-8,14H,3-5H2,1-2H3;1-5,9H,6-7H2.
What are the key properties of 4-(3-ethoxy-4-hydroxyphenyl)butan-2-one;2-phenylethanol?
4-(3-ethoxy-4-hydroxyphenyl)butan-2-one;2-phenylethanol has a molecular weight of 330.42 g/mol, XLogP of 3.53, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-ethoxy-4-hydroxyphenyl)butan-2-one;2-phenylethanol is sourced from PubChem (CID 137372095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).