About phenol;4-phenylbutan-2-one
phenol;4-phenylbutan-2-one (PubChem CID 160537429) has the molecular formula C16H18O2
and a molecular weight of 242.32 g/mol. Its IUPAC name is phenol;4-phenylbutan-2-one.
Molecular Properties
| Compound Name | phenol;4-phenylbutan-2-one |
| PubChem CID | 160537429 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | phenol;4-phenylbutan-2-one |
| SMILES | CC(=O)CCc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C10H12O.C6H6O/c1-9(11)7-8-10-5-3-2-4-6-10;7-6-4-2-1-3-5-6/h2-6H,7-8H2,1H3;1-5,7H |
| InChIKey | QWIMEDHGYAFYJB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenol;4-phenylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;4-phenylbutan-2-one?
The IUPAC name of phenol;4-phenylbutan-2-one (CID 160537429) is phenol;4-phenylbutan-2-one.
What is the SMILES notation for phenol;4-phenylbutan-2-one?
The canonical SMILES for phenol;4-phenylbutan-2-one is CC(=O)CCc1ccccc1.Oc1ccccc1.
What is the InChIKey of phenol;4-phenylbutan-2-one?
The InChIKey is QWIMEDHGYAFYJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O.C6H6O/c1-9(11)7-8-10-5-3-2-4-6-10;7-6-4-2-1-3-5-6/h2-6H,7-8H2,1H3;1-5,7H.
What are the key properties of phenol;4-phenylbutan-2-one?
phenol;4-phenylbutan-2-one has a molecular weight of 242.32 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;4-phenylbutan-2-one is sourced from PubChem (CID 160537429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).