C19H21BrO4 — CID 20989565
3-[5-bromo-3-methoxy-2-(3-phenylpropoxy)phenyl]propanoic acid (PubChem CID 20989565) has the molecular formula C19H21BrO4 and a molecular weight of 393.28 g/mol. Its IUPAC name is 3-[5-bromo-3-methoxy-2-(3-phenylpropoxy)phenyl]propanoic acid.
| Compound Name | 3-[5-bromo-3-methoxy-2-(3-phenylpropoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 20989565 |
| Molecular Formula | C19H21BrO4 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 3-[5-bromo-3-methoxy-2-(3-phenylpropoxy)phenyl]propanoic acid |
| SMILES | COc1cc(Br)cc(CCC(=O)O)c1OCCCc1ccccc1 |
| InChI | InChI=1S/C19H21BrO4/c1-23-17-13-16(20)12-15(9-10-18(21)22)19(17)24-11-5-8-14-6-3-2-4-7-14/h2-4,6-7,12-13H,5,8-11H2,1H3,(H,21,22) |
| InChIKey | IPNBIBQYNOMCHN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|