C44H54N2O7 — CID 162865428
(5R,7S)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-[3-[[(8R,10S)-8-benzyl-7-azaspiro[4.5]decan-10-yl]oxy]-4,5-dihydroxyphenyl]-5-hydroxy-9-phenylnonan-3-one (PubChem CID 162865428) has the molecular formula C44H54N2O7 and a molecular weight of 722.92 g/mol. Its IUPAC name is (5R,7S)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-[3-[[(8R,10S)-8-benzyl-7-azaspiro[4.5]decan-10-yl]oxy]-4,5-dihydroxyphenyl]-5-hydroxy-9-phenylnonan-3-one.
| Compound Name | (5R,7S)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-[3-[[(8R,10S)-8-benzyl-7-azaspiro[4.5]decan-10-yl]oxy]-4,5-dihydroxyphenyl]-5-hydroxy-9-phenylnonan-3-one |
|---|---|
| PubChem CID | 162865428 |
| Molecular Formula | C44H54N2O7 |
| Molecular Weight | 722.92 g/mol |
| Exact Mass | 722.39 |
| IUPAC Name | (5R,7S)-1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-[3-[[(8R,10S)-8-benzyl-7-azaspiro[4.5]decan-10-yl]oxy]-4,5-dihydroxyphenyl]-5-hydroxy-9-phenylnonan-3-one |
| SMILES | NCOc1cc(CCC(=O)C[C@H](O)C[C@H](CCc2ccccc2)c2cc(O)c(O)c(O[C@H]3C[C@@H](Cc4ccccc4)NCC34CCCC4)c2)ccc1O |
| InChI | InChI=1S/C44H54N2O7/c45-29-52-40-22-32(15-18-38(40)49)14-17-36(47)27-37(48)23-33(16-13-30-9-3-1-4-10-30)34-24-39(50)43(51)41(25-34)53-42-26-35(21-31-11-5-2-6-12-31)46-28-44(42)19-7-8-20-44/h1-6,9-12,15,18,22,24-25,33,35,37,42,46,48-51H,7-8,13-14,16-17,19-21,23,26-29,45H2/t33-,35+,37+,42-/m0/s1 |
| InChIKey | FJQSIJYGCWXOBN-CVQXIYMESA-N |
| XLogP | 7.07 |
| TPSA | 154.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.92 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|