C38H50N2O7 — CID 162862810
1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-(3,4-dihydroxy-5-piperidin-4-yloxyphenyl)-5-hydroxy-8-(1-phenylcyclohexyl)octan-3-one (PubChem CID 162862810) has the molecular formula C38H50N2O7 and a molecular weight of 646.82 g/mol. Its IUPAC name is 1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-(3,4-dihydroxy-5-piperidin-4-yloxyphenyl)-5-hydroxy-8-(1-phenylcyclohexyl)octan-3-one.
| Compound Name | 1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-(3,4-dihydroxy-5-piperidin-4-yloxyphenyl)-5-hydroxy-8-(1-phenylcyclohexyl)octan-3-one |
|---|---|
| PubChem CID | 162862810 |
| Molecular Formula | C38H50N2O7 |
| Molecular Weight | 646.82 g/mol |
| Exact Mass | 646.36 |
| IUPAC Name | 1-[3-(aminomethoxy)-4-hydroxyphenyl]-7-(3,4-dihydroxy-5-piperidin-4-yloxyphenyl)-5-hydroxy-8-(1-phenylcyclohexyl)octan-3-one |
| SMILES | NCOc1cc(CCC(=O)CC(O)CC(CC2(c3ccccc3)CCCCC2)c2cc(O)c(O)c(OC3CCNCC3)c2)ccc1O |
| InChI | InChI=1S/C38H50N2O7/c39-25-46-35-19-26(10-12-33(35)43)9-11-30(41)23-31(42)20-28(24-38(15-5-2-6-16-38)29-7-3-1-4-8-29)27-21-34(44)37(45)36(22-27)47-32-13-17-40-18-14-32/h1,3-4,7-8,10,12,19,21-22,28,31-32,40,42-45H,2,5-6,9,11,13-18,20,23-25,39H2 |
| InChIKey | GRRUUTDFASWPQM-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 154.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.82 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|