C21H28O6 — CID 150070360
5-[3,5-dihydroxy-7-(4-hydroxy-3-methylphenyl)heptyl]-3-methoxybenzene-1,2-diol (PubChem CID 150070360) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is 5-[3,5-dihydroxy-7-(4-hydroxy-3-methylphenyl)heptyl]-3-methoxybenzene-1,2-diol.
| Compound Name | 5-[3,5-dihydroxy-7-(4-hydroxy-3-methylphenyl)heptyl]-3-methoxybenzene-1,2-diol |
|---|---|
| PubChem CID | 150070360 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 5-[3,5-dihydroxy-7-(4-hydroxy-3-methylphenyl)heptyl]-3-methoxybenzene-1,2-diol |
| SMILES | COc1cc(CCC(O)CC(O)CCc2ccc(O)c(C)c2)cc(O)c1O |
| InChI | InChI=1S/C21H28O6/c1-13-9-14(5-8-18(13)24)3-6-16(22)12-17(23)7-4-15-10-19(25)21(26)20(11-15)27-2/h5,8-11,16-17,22-26H,3-4,6-7,12H2,1-2H3 |
| InChIKey | DPDKXXWXLBXZQK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|