C21H26O3 — CID 58302080
(5S)-1-(3,4-dihydroxyphenyl)-5-methyl-7-(4-methylphenyl)heptan-3-one (PubChem CID 58302080) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (5S)-1-(3,4-dihydroxyphenyl)-5-methyl-7-(4-methylphenyl)heptan-3-one.
| Compound Name | (5S)-1-(3,4-dihydroxyphenyl)-5-methyl-7-(4-methylphenyl)heptan-3-one |
|---|---|
| PubChem CID | 58302080 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (5S)-1-(3,4-dihydroxyphenyl)-5-methyl-7-(4-methylphenyl)heptan-3-one |
| SMILES | Cc1ccc(CC[C@H](C)CC(=O)CCc2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C21H26O3/c1-15-3-6-17(7-4-15)8-5-16(2)13-19(22)11-9-18-10-12-20(23)21(24)14-18/h3-4,6-7,10,12,14,16,23-24H,5,8-9,11,13H2,1-2H3/t16-/m0/s1 |
| InChIKey | QNACNTIFNYLEEH-INIZCTEOSA-N |
| XLogP | 4.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|