C19H28O3 — CID 159303536
1-(4-hydroxy-3-methylphenyl)-10-methylundecane-3,8-dione (PubChem CID 159303536) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is 1-(4-hydroxy-3-methylphenyl)-10-methylundecane-3,8-dione.
| Compound Name | 1-(4-hydroxy-3-methylphenyl)-10-methylundecane-3,8-dione |
|---|---|
| PubChem CID | 159303536 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 1-(4-hydroxy-3-methylphenyl)-10-methylundecane-3,8-dione |
| SMILES | Cc1cc(CCC(=O)CCCCC(=O)CC(C)C)ccc1O |
| InChI | InChI=1S/C19H28O3/c1-14(2)12-18(21)7-5-4-6-17(20)10-8-16-9-11-19(22)15(3)13-16/h9,11,13-14,22H,4-8,10,12H2,1-3H3 |
| InChIKey | DNSXZTKZSDQEGT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|