C19H28O3 — CID 58559668
(E)-1-[4-hydroxy-3-(hydroxymethyl)phenyl]-10-methylundec-8-en-3-one (PubChem CID 58559668) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (E)-1-[4-hydroxy-3-(hydroxymethyl)phenyl]-10-methylundec-8-en-3-one.
| Compound Name | (E)-1-[4-hydroxy-3-(hydroxymethyl)phenyl]-10-methylundec-8-en-3-one |
|---|---|
| PubChem CID | 58559668 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (E)-1-[4-hydroxy-3-(hydroxymethyl)phenyl]-10-methylundec-8-en-3-one |
| SMILES | CC(C)/C=C/CCCCC(=O)CCc1ccc(O)c(CO)c1 |
| InChI | InChI=1S/C19H28O3/c1-15(2)7-5-3-4-6-8-18(21)11-9-16-10-12-19(22)17(13-16)14-20/h5,7,10,12-13,15,20,22H,3-4,6,8-9,11,14H2,1-2H3/b7-5+ |
| InChIKey | LZZFHXQMBIGFEI-FNORWQNLSA-N |
| XLogP | 4.16 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|