C29H39N2O6+ — CID 159348229
[3-(dimethylcarbamoyl)pyridin-1-ium-1-yl]methyl [2-methoxy-4-[(E)-10-methyl-3-oxoundec-8-enyl]phenyl] carbonate (PubChem CID 159348229) has the molecular formula C29H39N2O6+ and a molecular weight of 511.64 g/mol. Its IUPAC name is [3-(dimethylcarbamoyl)pyridin-1-ium-1-yl]methyl [2-methoxy-4-[(E)-10-methyl-3-oxoundec-8-enyl]phenyl] carbonate.
| Compound Name | [3-(dimethylcarbamoyl)pyridin-1-ium-1-yl]methyl [2-methoxy-4-[(E)-10-methyl-3-oxoundec-8-enyl]phenyl] carbonate |
|---|---|
| PubChem CID | 159348229 |
| Molecular Formula | C29H39N2O6+ |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | [3-(dimethylcarbamoyl)pyridin-1-ium-1-yl]methyl [2-methoxy-4-[(E)-10-methyl-3-oxoundec-8-enyl]phenyl] carbonate |
| SMILES | COc1cc(CCC(=O)CCCC/C=C/C(C)C)ccc1OC(=O)OC[n+]1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C29H39N2O6/c1-22(2)11-8-6-7-9-13-25(32)16-14-23-15-17-26(27(19-23)35-5)37-29(34)36-21-31-18-10-12-24(20-31)28(33)30(3)4/h8,10-12,15,17-20,22H,6-7,9,13-14,16,21H2,1-5H3/q+1/b11-8+ |
| InChIKey | LGZNUJONMJZDLE-DHZHZOJOSA-N |
| XLogP | 5.13 |
| TPSA | 86.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|