C18H25NO4 — CID 67151073
(4-carbamoyl-2-methoxyphenyl) 8-methylnon-6-enoate (PubChem CID 67151073) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is (4-carbamoyl-2-methoxyphenyl) 8-methylnon-6-enoate.
| Compound Name | (4-carbamoyl-2-methoxyphenyl) 8-methylnon-6-enoate |
|---|---|
| PubChem CID | 67151073 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | (4-carbamoyl-2-methoxyphenyl) 8-methylnon-6-enoate |
| SMILES | COc1cc(C(N)=O)ccc1OC(=O)CCCCC=CC(C)C |
| InChI | InChI=1S/C18H25NO4/c1-13(2)8-6-4-5-7-9-17(20)23-15-11-10-14(18(19)21)12-16(15)22-3/h6,8,10-13H,4-5,7,9H2,1-3H3,(H2,19,21) |
| InChIKey | RLYLWSIKGHNPBF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|