C20H27NO8 — CID 143078484
4-nitrooxybutyl 3-methoxy-4-[(Z)-oct-5-enoyl]oxybenzoate (PubChem CID 143078484) has the molecular formula C20H27NO8 and a molecular weight of 409.44 g/mol. Its IUPAC name is 4-nitrooxybutyl 3-methoxy-4-[(Z)-oct-5-enoyl]oxybenzoate.
| Compound Name | 4-nitrooxybutyl 3-methoxy-4-[(Z)-oct-5-enoyl]oxybenzoate |
|---|---|
| PubChem CID | 143078484 |
| Molecular Formula | C20H27NO8 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 4-nitrooxybutyl 3-methoxy-4-[(Z)-oct-5-enoyl]oxybenzoate |
| SMILES | CC/C=C\CCCC(=O)Oc1ccc(C(=O)OCCCCO[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H27NO8/c1-3-4-5-6-7-10-19(22)29-17-12-11-16(15-18(17)26-2)20(23)27-13-8-9-14-28-21(24)25/h4-5,11-12,15H,3,6-10,13-14H2,1-2H3/b5-4- |
| InChIKey | ALLIIDNKVQSVKB-PLNGDYQASA-N |
| XLogP | 3.88 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|