C24H32N2O9 — CID 143380873
[2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 2-[[(Z)-hept-5-enoyl]amino]propanoate (PubChem CID 143380873) has the molecular formula C24H32N2O9 and a molecular weight of 492.53 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 2-[[(Z)-hept-5-enoyl]amino]propanoate.
| Compound Name | [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 2-[[(Z)-hept-5-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 143380873 |
| Molecular Formula | C24H32N2O9 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 2-[[(Z)-hept-5-enoyl]amino]propanoate |
| SMILES | C/C=C\CCCC(=O)NC(C)C(=O)Oc1ccc(/C=C/C(=O)OCCCCO[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C24H32N2O9/c1-4-5-6-7-10-22(27)25-18(2)24(29)35-20-13-11-19(17-21(20)32-3)12-14-23(28)33-15-8-9-16-34-26(30)31/h4-5,11-14,17-18H,6-10,15-16H2,1-3H3,(H,25,27)/b5-4-,14-12+ |
| InChIKey | ZQJDMFHDBVZMPN-NPKGFUJDSA-N |
| XLogP | 3.40 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|